C8H14N2 — CID 123339109
(Z)-1-N-ethyl-2-N-ethylidenebut-2-ene-1,2-diimine (PubChem CID 123339109) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (Z)-1-N-ethyl-2-N-ethylidenebut-2-ene-1,2-diimine.
| Compound Name | (Z)-1-N-ethyl-2-N-ethylidenebut-2-ene-1,2-diimine |
|---|---|
| PubChem CID | 123339109 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (Z)-1-N-ethyl-2-N-ethylidenebut-2-ene-1,2-diimine |
| SMILES | C/C=C(/C=N/CC)\N=C\C |
| InChI | InChI=1S/C8H14N2/c1-4-8(10-6-3)7-9-5-2/h4,6-7H,5H2,1-3H3/b8-4-,9-7+,10-6+ |
| InChIKey | XZMTXIROSUDVLK-IHUNFIOWSA-N |
| XLogP | 2.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|