About 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine
1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine (PubChem CID 123339362) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine |
| PubChem CID | 123339362 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine |
| SMILES | C=CC(=CC)CN1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H17F2N/c1-3-10(4-2)8-14-7-5-6-11(12,13)9-14/h3-4H,1,5-9H2,2H3 |
| InChIKey | AYQDBFIPHBSLIS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine?
The IUPAC name of 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine (CID 123339362) is 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine.
What is the SMILES notation for 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine?
The canonical SMILES for 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine is C=CC(=CC)CN1CCCC(F)(F)C1.
What is the InChIKey of 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine?
The InChIKey is AYQDBFIPHBSLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N/c1-3-10(4-2)8-14-7-5-6-11(12,13)9-14/h3-4H,1,5-9H2,2H3.
What are the key properties of 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine?
1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine has a molecular weight of 201.26 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethenylbut-2-enyl)-3,3-difluoropiperidine is sourced from PubChem (CID 123339362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).