About 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane
2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane (PubChem CID 123339404) has the molecular formula C10H26O4Si2
and a molecular weight of 266.49 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane.
Molecular Properties
| Compound Name | 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane |
| PubChem CID | 123339404 |
| Molecular Formula | C10H26O4Si2 |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane |
| SMILES | COC(C[SiH2]CC[SiH2]CC(OC)OC)OC |
| InChI | InChI=1S/C10H26O4Si2/c1-11-9(12-2)7-15-5-6-16-8-10(13-3)14-4/h9-10H,5-8,15-16H2,1-4H3 |
| InChIKey | YCENHZWCWSMUTF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane?
The IUPAC name of 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane (CID 123339404) is 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane.
What is the SMILES notation for 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane?
The canonical SMILES for 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane is COC(C[SiH2]CC[SiH2]CC(OC)OC)OC.
What is the InChIKey of 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane?
The InChIKey is YCENHZWCWSMUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26O4Si2/c1-11-9(12-2)7-15-5-6-16-8-10(13-3)14-4/h9-10H,5-8,15-16H2,1-4H3.
What are the key properties of 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane?
2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane has a molecular weight of 266.49 g/mol, XLogP of 0.23, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethyl-[2-(2,2-dimethoxyethylsilyl)ethyl]silane is sourced from PubChem (CID 123339404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).