About 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole
2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole (PubChem CID 123339641) has the molecular formula C14H26N2S
and a molecular weight of 254.44 g/mol. Its IUPAC name is 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole |
| PubChem CID | 123339641 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole |
| SMILES | CCC(CC)Cc1nnc(CC(CC)CC)s1 |
| InChI | InChI=1S/C14H26N2S/c1-5-11(6-2)9-13-15-16-14(17-13)10-12(7-3)8-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | VZMKDKDNPXOQHU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole?
The IUPAC name of 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole (CID 123339641) is 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole?
The canonical SMILES for 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole is CCC(CC)Cc1nnc(CC(CC)CC)s1.
What is the InChIKey of 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole?
The InChIKey is VZMKDKDNPXOQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2S/c1-5-11(6-2)9-13-15-16-14(17-13)10-12(7-3)8-4/h11-12H,5-10H2,1-4H3.
What are the key properties of 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole?
2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole has a molecular weight of 254.44 g/mol, XLogP of 4.50, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2-ethylbutyl)-1,3,4-thiadiazole is sourced from PubChem (CID 123339641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).