C26H29N3O2 — CID 123339799
3-(2,8-dimethyl-6,7-dihydropyrido[1,2-a]azepin-9-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one (PubChem CID 123339799) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-(2,8-dimethyl-6,7-dihydropyrido[1,2-a]azepin-9-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(2,8-dimethyl-6,7-dihydropyrido[1,2-a]azepin-9-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 123339799 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-(2,8-dimethyl-6,7-dihydropyrido[1,2-a]azepin-9-yl)-7-(4-methylpiperazin-1-yl)chromen-2-one |
| SMILES | CC1=CC2=CC(c3cc4ccc(N5CCN(C)CC5)cc4oc3=O)=C(C)CCN2C=C1 |
| InChI | InChI=1S/C26H29N3O2/c1-18-6-8-28-9-7-19(2)23(16-22(28)14-18)24-15-20-4-5-21(17-25(20)31-26(24)30)29-12-10-27(3)11-13-29/h4-6,8,14-17H,7,9-13H2,1-3H3 |
| InChIKey | GXLWTGCIWDBCER-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|