C14H20F2N2O4 — CID 123339892
2,2-difluoro-6-(2-formamido-3-methylbutanoyl)-6-azaspiro[3.4]octane-7-carboxylic acid (PubChem CID 123339892) has the molecular formula C14H20F2N2O4 and a molecular weight of 318.32 g/mol. Its IUPAC name is 2,2-difluoro-6-(2-formamido-3-methylbutanoyl)-6-azaspiro[3.4]octane-7-carboxylic acid.
| Compound Name | 2,2-difluoro-6-(2-formamido-3-methylbutanoyl)-6-azaspiro[3.4]octane-7-carboxylic acid |
|---|---|
| PubChem CID | 123339892 |
| Molecular Formula | C14H20F2N2O4 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2,2-difluoro-6-(2-formamido-3-methylbutanoyl)-6-azaspiro[3.4]octane-7-carboxylic acid |
| SMILES | CC(C)C(NC=O)C(=O)N1CC2(CC1C(=O)O)CC(F)(F)C2 |
| InChI | InChI=1S/C14H20F2N2O4/c1-8(2)10(17-7-19)11(20)18-6-13(3-9(18)12(21)22)4-14(15,16)5-13/h7-10H,3-6H2,1-2H3,(H,17,19)(H,21,22) |
| InChIKey | JEMKJCQXMRNJND-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|