C30H45FN2OSi — CID 123339939
[7a-[3-di(propan-2-yl)silylbutyl]-5-(4-fluorophenyl)imino-6-methanimidoyl-1-prop-2-enyl-2,3,6,7-tetrahydroinden-1-yl]methanol (PubChem CID 123339939) has the molecular formula C30H45FN2OSi and a molecular weight of 496.79 g/mol. Its IUPAC name is [7a-[3-di(propan-2-yl)silylbutyl]-5-(4-fluorophenyl)imino-6-methanimidoyl-1-prop-2-enyl-2,3,6,7-tetrahydroinden-1-yl]methanol.
| Compound Name | [7a-[3-di(propan-2-yl)silylbutyl]-5-(4-fluorophenyl)imino-6-methanimidoyl-1-prop-2-enyl-2,3,6,7-tetrahydroinden-1-yl]methanol |
|---|---|
| PubChem CID | 123339939 |
| Molecular Formula | C30H45FN2OSi |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | [7a-[3-di(propan-2-yl)silylbutyl]-5-(4-fluorophenyl)imino-6-methanimidoyl-1-prop-2-enyl-2,3,6,7-tetrahydroinden-1-yl]methanol |
| SMILES | [H]/N=C/C1CC2(CCC(C)[SiH](C(C)C)C(C)C)C(=C/C1=N\c1ccc(F)cc1)CCC2(CO)CC=C |
| InChI | InChI=1S/C30H45FN2OSi/c1-7-14-29(20-34)15-13-25-17-28(33-27-10-8-26(31)9-11-27)24(19-32)18-30(25,29)16-12-23(6)35(21(2)3)22(4)5/h7-11,17,19,21-24,32,34-35H,1,12-16,18,20H2,2-6H3/b32-19+,33-28+ |
| InChIKey | JMHRBFSCRVIHBQ-DOAMVSPWSA-N |
| XLogP | 8.05 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|