About 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate
2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate (PubChem CID 123340441) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate.
Molecular Properties
| Compound Name | 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate |
| PubChem CID | 123340441 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate |
| SMILES | [H]/N=C(\CNNC)SCC(C=C=C)=CCCC |
| InChI | InChI=1S/C12H21N3S/c1-4-6-8-11(7-5-2)10-16-12(13)9-15-14-3/h7-8,13-15H,2,4,6,9-10H2,1,3H3/b11-8?,13-12+ |
| InChIKey | VXLBJLIUQGURMS-ZHSPKSDKSA-N |
| XLogP | 2.49 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate?
The IUPAC name of 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate (CID 123340441) is 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate.
What is the SMILES notation for 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate?
The canonical SMILES for 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate is [H]/N=C(\CNNC)SCC(C=C=C)=CCCC.
What is the InChIKey of 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate?
The InChIKey is VXLBJLIUQGURMS-ZHSPKSDKSA-N. The full InChI is InChI=1S/C12H21N3S/c1-4-6-8-11(7-5-2)10-16-12(13)9-15-14-3/h7-8,13-15H,2,4,6,9-10H2,1,3H3/b11-8?,13-12+.
What are the key properties of 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate?
2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate has a molecular weight of 239.39 g/mol, XLogP of 2.49, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propa-1,2-dienylhex-2-enyl 2-(2-methylhydrazinyl)ethanimidothioate is sourced from PubChem (CID 123340441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).