C23H34O4 — CID 123340621
4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol (PubChem CID 123340621) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol.
| Compound Name | 4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol |
|---|---|
| PubChem CID | 123340621 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol |
| SMILES | C=CC1OC2C3=C(C)CCC(O)(CC4C5COC5CCC4(C)C2O1)C3(C)C |
| InChI | InChI=1S/C23H34O4/c1-6-17-26-19-18-13(2)7-10-23(24,21(18,3)4)11-15-14-12-25-16(14)8-9-22(15,5)20(19)27-17/h6,14-17,19-20,24H,1,7-12H2,2-5H3 |
| InChIKey | UBPPXIIIGWJQNN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|