C29H34ClN3O7 — CID 123340761
(4S,4aS,5aR)-7-chloro-8-[[cyclopropyl(cyclopropylmethyl)amino]methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123340761) has the molecular formula C29H34ClN3O7 and a molecular weight of 572.06 g/mol. Its IUPAC name is (4S,4aS,5aR)-7-chloro-8-[[cyclopropyl(cyclopropylmethyl)amino]methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR)-7-chloro-8-[[cyclopropyl(cyclopropylmethyl)amino]methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123340761 |
| Molecular Formula | C29H34ClN3O7 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (4S,4aS,5aR)-7-chloro-8-[[cyclopropyl(cyclopropylmethyl)amino]methyl]-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cc(CN(CC5CC5)C5CC5)c(Cl)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H34ClN3O7/c1-32(2)23-17-8-13-7-16-20(18(34)9-14(22(16)30)11-33(15-5-6-15)10-12-3-4-12)24(35)19(13)26(37)29(17,40)27(38)21(25(23)36)28(31)39/h9,12-13,15,17,19,21,23,34,40H,3-8,10-11H2,1-2H3,(H2,31,39)/t13-,17-,19?,21?,23-,29?/m0/s1 |
| InChIKey | BWMIALFSGPAKMR-LBLUUBSLSA-N |
| XLogP | 0.89 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|