C13H23N3S — CID 123343480
N'-[(4E,7Z)-4-methyl-6,9-dihydrothiazonin-3-yl]-N'-propylethane-1,2-diamine (PubChem CID 123343480) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is N'-[(4E,7Z)-4-methyl-6,9-dihydrothiazonin-3-yl]-N'-propylethane-1,2-diamine.
| Compound Name | N'-[(4E,7Z)-4-methyl-6,9-dihydrothiazonin-3-yl]-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 123343480 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N'-[(4E,7Z)-4-methyl-6,9-dihydrothiazonin-3-yl]-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN)C1=NSC/C=C\C/C=C/1C |
| InChI | InChI=1S/C13H23N3S/c1-3-9-16(10-8-14)13-12(2)7-5-4-6-11-17-15-13/h4,6-7H,3,5,8-11,14H2,1-2H3/b6-4-,12-7+,15-13? |
| InChIKey | JFBRMRIQQOHTKK-HYJJPLKDSA-N |
| XLogP | 2.61 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|