C22H38O4Si — CID 123343518
tert-butyl-[[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxy]-dimethylsilane (PubChem CID 123343518) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is tert-butyl-[[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 123343518 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | tert-butyl-[[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]oxy]-dimethylsilane |
| SMILES | CO[C@@H]1C(O[Si](C)(C)C(C)(C)C)=CC[C@]2(CO2)[C@H]1C1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-15(2)10-11-17-21(6,25-17)19-18(23-7)16(12-13-22(19)14-24-22)26-27(8,9)20(3,4)5/h10,12,17-19H,11,13-14H2,1-9H3/t17-,18-,19-,21?,22+/m1/s1 |
| InChIKey | REJIUEDFJJOFTL-IWOVDKSMSA-N |
| XLogP | 5.21 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|