C24H32F3N5O2Si — CID 123343673
2-[[3-[6-[6-(2,2-dimethylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123343673) has the molecular formula C24H32F3N5O2Si and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[[3-[6-[6-(2,2-dimethylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[6-[6-(2,2-dimethylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123343673 |
| Molecular Formula | C24H32F3N5O2Si |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-[[3-[6-[6-(2,2-dimethylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)n(COCC[Si](C)(C)C)n3)cn2)cn1 |
| InChI | InChI=1S/C24H32F3N5O2Si/c1-23(2,3)15-34-20-10-8-17(13-29-20)19-9-7-18(14-28-19)21-30-22(24(25,26)27)32(31-21)16-33-11-12-35(4,5)6/h7-10,13-14H,11-12,15-16H2,1-6H3 |
| InChIKey | OKIQMUKBNQICII-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|