C16H19NO2 — CID 123343760
N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide (PubChem CID 123343760) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide.
| Compound Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 123343760 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]tricyclo[4.3.0.02,4]nona-1(9),3,5,7-tetraene-7-carboxamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)C1=CC=C2C1=CC1=CC12 |
| InChI | InChI=1S/C16H19NO2/c1-16(2,3)14(8-18)17-15(19)11-5-4-10-12-6-9(12)7-13(10)11/h4-7,12,14,18H,8H2,1-3H3,(H,17,19)/t12?,14-/m1/s1 |
| InChIKey | SSIYJMKBNLYDNR-TYZXPVIJSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |