C8H12F2O — CID 123343799
3-(difluoromethoxy)-4-methylhexa-1,3-diene (PubChem CID 123343799) has the molecular formula C8H12F2O and a molecular weight of 162.18 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methylhexa-1,3-diene.
| Compound Name | 3-(difluoromethoxy)-4-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 123343799 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-(difluoromethoxy)-4-methylhexa-1,3-diene |
| SMILES | C=CC(OC(F)F)=C(C)CC |
| InChI | InChI=1S/C8H12F2O/c1-4-6(3)7(5-2)11-8(9)10/h5,8H,2,4H2,1,3H3 |
| InChIKey | AYNRNKCGGSIJSN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|