About 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine
2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine (PubChem CID 123343900) has the molecular formula C8H11Cl2N
and a molecular weight of 192.09 g/mol. Its IUPAC name is 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine |
| PubChem CID | 123343900 |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine |
| SMILES | CC1CCC(Cl)=NC=C1CCl |
| InChI | InChI=1S/C8H11Cl2N/c1-6-2-3-8(10)11-5-7(6)4-9/h5-6H,2-4H2,1H3 |
| InChIKey | WPISMSHTQUHCMM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine?
The IUPAC name of 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine (CID 123343900) is 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine.
What is the SMILES notation for 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine?
The canonical SMILES for 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine is CC1CCC(Cl)=NC=C1CCl.
What is the InChIKey of 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine?
The InChIKey is WPISMSHTQUHCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl2N/c1-6-2-3-8(10)11-5-7(6)4-9/h5-6H,2-4H2,1H3.
What are the key properties of 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine?
2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine has a molecular weight of 192.09 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(chloromethyl)-5-methyl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 123343900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).