About 2-ethenylpyrrol-1-amine
2-ethenylpyrrol-1-amine (PubChem CID 123344107) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 2-ethenylpyrrol-1-amine.
Molecular Properties
| Compound Name | 2-ethenylpyrrol-1-amine |
| PubChem CID | 123344107 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 2-ethenylpyrrol-1-amine |
| SMILES | C=Cc1cccn1N |
| InChI | InChI=1S/C6H8N2/c1-2-6-4-3-5-8(6)7/h2-5H,1,7H2 |
| InChIKey | MHWVCWAUJBYBAJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethenylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpyrrol-1-amine?
The IUPAC name of 2-ethenylpyrrol-1-amine (CID 123344107) is 2-ethenylpyrrol-1-amine.
What is the SMILES notation for 2-ethenylpyrrol-1-amine?
The canonical SMILES for 2-ethenylpyrrol-1-amine is C=Cc1cccn1N.
What is the InChIKey of 2-ethenylpyrrol-1-amine?
The InChIKey is MHWVCWAUJBYBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-2-6-4-3-5-8(6)7/h2-5H,1,7H2.
What are the key properties of 2-ethenylpyrrol-1-amine?
2-ethenylpyrrol-1-amine has a molecular weight of 108.14 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpyrrol-1-amine is sourced from PubChem (CID 123344107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).