C17H28N2 — CID 123344536
1-cycloocta-1,4-dien-1-yl-3,4-dimethylheptane-1,2-diimine (PubChem CID 123344536) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 1-cycloocta-1,4-dien-1-yl-3,4-dimethylheptane-1,2-diimine.
| Compound Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethylheptane-1,2-diimine |
|---|---|
| PubChem CID | 123344536 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-cycloocta-1,4-dien-1-yl-3,4-dimethylheptane-1,2-diimine |
| SMILES | [H]/N=C(C1=CCC=CCCC1)\C(=N\[H])C(C)C(C)CCC |
| InChI | InChI=1S/C17H28N2/c1-4-10-13(2)14(3)16(18)17(19)15-11-8-6-5-7-9-12-15/h5-6,11,13-14,18-19H,4,7-10,12H2,1-3H3/b6-5?,15-11?,18-16+,19-17- |
| InChIKey | AMILIZFIHVANHM-QXKDHANSSA-N |
| XLogP | 5.15 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|