C18H35N3 — CID 123345375
1,4-bis(2,4,4-trimethylpentan-2-yl)triazole (PubChem CID 123345375) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 1,4-bis(2,4,4-trimethylpentan-2-yl)triazole.
| Compound Name | 1,4-bis(2,4,4-trimethylpentan-2-yl)triazole |
|---|---|
| PubChem CID | 123345375 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 1,4-bis(2,4,4-trimethylpentan-2-yl)triazole |
| SMILES | CC(C)(C)CC(C)(C)c1cn(C(C)(C)CC(C)(C)C)nn1 |
| InChI | InChI=1S/C18H35N3/c1-15(2,3)12-17(7,8)14-11-21(20-19-14)18(9,10)13-16(4,5)6/h11H,12-13H2,1-10H3 |
| InChIKey | GZGRAFZAIMORED-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |