C21H32F3N5O2 — CID 123345563
N-(1-aminoethylidene)-2-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 123345563) has the molecular formula C21H32F3N5O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(1-aminoethylidene)-2-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123345563 |
| Molecular Formula | C21H32F3N5O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-(1-aminoethylidene)-2-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCC(NC1CCCCC1)C(CO)CNc1ncc(C(F)(F)F)cc1C(=O)/N=C(\C)N |
| InChI | InChI=1S/C21H32F3N5O2/c1-3-18(29-16-7-5-4-6-8-16)14(12-30)10-26-19-17(20(31)28-13(2)25)9-15(11-27-19)21(22,23)24/h9,11,14,16,18,29-30H,3-8,10,12H2,1-2H3,(H,26,27)(H2,25,28,31) |
| InChIKey | IGZWLRKHJVEAHL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|