C25H24N2O2 — CID 123345591
2,9-dimethyl-5,12-dihydronaphtho[3,2-b]acridine-7,14-dione;ethanamine (PubChem CID 123345591) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2,9-dimethyl-5,12-dihydronaphtho[3,2-b]acridine-7,14-dione;ethanamine.
| Compound Name | 2,9-dimethyl-5,12-dihydronaphtho[3,2-b]acridine-7,14-dione;ethanamine |
|---|---|
| PubChem CID | 123345591 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2,9-dimethyl-5,12-dihydronaphtho[3,2-b]acridine-7,14-dione;ethanamine |
| SMILES | CCN.Cc1ccc2c(c1)C(=O)c1cc3[nH]c4ccc(C)cc4c(=O)c3cc1C2 |
| InChI | InChI=1S/C23H17NO2.C2H7N/c1-12-3-5-14-9-15-10-19-21(11-17(15)22(25)16(14)7-12)24-20-6-4-13(2)8-18(20)23(19)26;1-2-3/h3-8,10-11H,9H2,1-2H3,(H,24,26);2-3H2,1H3 |
| InChIKey | LZRADHNPSRSYDL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|