C23H27ClN8S — CID 123345897
2-[1-[4-[(2-aminoethylamino)methyl]-2-pyridinyl]-2-iminopropyl]-4-[(4-chlorophenyl)methyl]-N'-methanimidoyl-1,3-thiazole-5-carboximidamide (PubChem CID 123345897) has the molecular formula C23H27ClN8S and a molecular weight of 483.05 g/mol. Its IUPAC name is 2-[1-[4-[(2-aminoethylamino)methyl]-2-pyridinyl]-2-iminopropyl]-4-[(4-chlorophenyl)methyl]-N'-methanimidoyl-1,3-thiazole-5-carboximidamide.
| Compound Name | 2-[1-[4-[(2-aminoethylamino)methyl]-2-pyridinyl]-2-iminopropyl]-4-[(4-chlorophenyl)methyl]-N'-methanimidoyl-1,3-thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 123345897 |
| Molecular Formula | C23H27ClN8S |
| Molecular Weight | 483.05 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[1-[4-[(2-aminoethylamino)methyl]-2-pyridinyl]-2-iminopropyl]-4-[(4-chlorophenyl)methyl]-N'-methanimidoyl-1,3-thiazole-5-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(C(/C(C)=N/[H])c2cc(CNCCN)ccn2)nc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H27ClN8S/c1-14(27)20(18-11-16(6-8-30-18)12-29-9-7-25)23-32-19(21(33-23)22(28)31-13-26)10-15-2-4-17(24)5-3-15/h2-6,8,11,13,20,27,29H,7,9-10,12,25H2,1H3,(H3,26,28,31)/b27-14+ |
| InChIKey | DWPDQMLSANQONX-MZJWZYIUSA-N |
| XLogP | 3.31 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.05 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|