About N'-(ethyliminomethyl)-N,N-dimethylethanimidamide
N'-(ethyliminomethyl)-N,N-dimethylethanimidamide (PubChem CID 123345967) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N'-(ethyliminomethyl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(ethyliminomethyl)-N,N-dimethylethanimidamide |
| PubChem CID | 123345967 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N'-(ethyliminomethyl)-N,N-dimethylethanimidamide |
| SMILES | CC/N=C/N=C(\C)N(C)C |
| InChI | InChI=1S/C7H15N3/c1-5-8-6-9-7(2)10(3)4/h6H,5H2,1-4H3/b8-6+,9-7+ |
| InChIKey | XVKQPXZNQDTUQU-CDJQDVQCSA-N |
| XLogP | 1.01 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(ethyliminomethyl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(ethyliminomethyl)-N,N-dimethylethanimidamide?
The IUPAC name of N'-(ethyliminomethyl)-N,N-dimethylethanimidamide (CID 123345967) is N'-(ethyliminomethyl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(ethyliminomethyl)-N,N-dimethylethanimidamide?
The canonical SMILES for N'-(ethyliminomethyl)-N,N-dimethylethanimidamide is CC/N=C/N=C(\C)N(C)C.
What is the InChIKey of N'-(ethyliminomethyl)-N,N-dimethylethanimidamide?
The InChIKey is XVKQPXZNQDTUQU-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H15N3/c1-5-8-6-9-7(2)10(3)4/h6H,5H2,1-4H3/b8-6+,9-7+.
What are the key properties of N'-(ethyliminomethyl)-N,N-dimethylethanimidamide?
N'-(ethyliminomethyl)-N,N-dimethylethanimidamide has a molecular weight of 141.22 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(ethyliminomethyl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 123345967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).