C6H12N2 — CID 123346046
3,5-dimethyl-4-methylidenepyrazolidine (PubChem CID 123346046) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 3,5-dimethyl-4-methylidenepyrazolidine.
| Compound Name | 3,5-dimethyl-4-methylidenepyrazolidine |
|---|---|
| PubChem CID | 123346046 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 3,5-dimethyl-4-methylidenepyrazolidine |
| SMILES | C=C1C(C)NNC1C |
| InChI | InChI=1S/C6H12N2/c1-4-5(2)7-8-6(4)3/h5-8H,1H2,2-3H3 |
| InChIKey | CXQACYIQXYTQLB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|