C18H24 — CID 123346814
pentacyclo[9.3.1.12,6.14,8.19,13]octadeca-1,8-diene (PubChem CID 123346814) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is pentacyclo[9.3.1.12,6.14,8.19,13]octadeca-1,8-diene.
| Compound Name | pentacyclo[9.3.1.12,6.14,8.19,13]octadeca-1,8-diene |
|---|---|
| PubChem CID | 123346814 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | pentacyclo[9.3.1.12,6.14,8.19,13]octadeca-1,8-diene |
| SMILES | C1C2=C3CC4CC(=C5CC1CC(C2)C5)CC(C3)C4 |
| InChI | InChI=1S/C18H24/c1-11-3-15-5-12(1)6-16(4-11)18-9-13-2-14(10-18)8-17(15)7-13/h11-14H,1-10H2/b17-15-,18-16- |
| InChIKey | DNYUBXUDNCIRCP-IQRFGFHNSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|