C21H32N4 — CID 123347256
10-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4,4a,9a-hexahydroacridin-9-imine (PubChem CID 123347256) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 10-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4,4a,9a-hexahydroacridin-9-imine.
| Compound Name | 10-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4,4a,9a-hexahydroacridin-9-imine |
|---|---|
| PubChem CID | 123347256 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 10-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4,4a,9a-hexahydroacridin-9-imine |
| SMILES | [H]/N=C1\c2ccccc2N(CCCN2CCN(C)CC2)C2CCCCC12 |
| InChI | InChI=1S/C21H32N4/c1-23-13-15-24(16-14-23)11-6-12-25-19-9-4-2-7-17(19)21(22)18-8-3-5-10-20(18)25/h2,4,7,9,18,20,22H,3,5-6,8,10-16H2,1H3/b22-21+ |
| InChIKey | CHCNOERVZHUWOY-QURGRASLSA-N |
| XLogP | 3.07 |
| TPSA | 33.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|