About (2Z)-N'-methylhexa-2,4,5-trienimidamide
(2Z)-N'-methylhexa-2,4,5-trienimidamide (PubChem CID 123347342) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (2Z)-N'-methylhexa-2,4,5-trienimidamide.
Molecular Properties
| Compound Name | (2Z)-N'-methylhexa-2,4,5-trienimidamide |
| PubChem CID | 123347342 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (2Z)-N'-methylhexa-2,4,5-trienimidamide |
| SMILES | C=C=C/C=C\C(N)=N\C |
| InChI | InChI=1S/C7H10N2/c1-3-4-5-6-7(8)9-2/h4-6H,1H2,2H3,(H2,8,9)/b6-5- |
| InChIKey | LBLLRIMYRCISOD-WAYWQWQTSA-N |
| XLogP | 0.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N'-methylhexa-2,4,5-trienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N'-methylhexa-2,4,5-trienimidamide?
The IUPAC name of (2Z)-N'-methylhexa-2,4,5-trienimidamide (CID 123347342) is (2Z)-N'-methylhexa-2,4,5-trienimidamide.
What is the SMILES notation for (2Z)-N'-methylhexa-2,4,5-trienimidamide?
The canonical SMILES for (2Z)-N'-methylhexa-2,4,5-trienimidamide is C=C=C/C=C\C(N)=N\C.
What is the InChIKey of (2Z)-N'-methylhexa-2,4,5-trienimidamide?
The InChIKey is LBLLRIMYRCISOD-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H10N2/c1-3-4-5-6-7(8)9-2/h4-6H,1H2,2H3,(H2,8,9)/b6-5-.
What are the key properties of (2Z)-N'-methylhexa-2,4,5-trienimidamide?
(2Z)-N'-methylhexa-2,4,5-trienimidamide has a molecular weight of 122.17 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N'-methylhexa-2,4,5-trienimidamide is sourced from PubChem (CID 123347342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).