C29H40O3S — CID 123348328
(1S)-3-[2-[(3aS,7aR)-1-[4-(benzenesulfonyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 123348328) has the molecular formula C29H40O3S and a molecular weight of 468.70 g/mol. Its IUPAC name is (1S)-3-[2-[(3aS,7aR)-1-[4-(benzenesulfonyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S)-3-[2-[(3aS,7aR)-1-[4-(benzenesulfonyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 123348328 |
| Molecular Formula | C29H40O3S |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1S)-3-[2-[(3aS,7aR)-1-[4-(benzenesulfonyl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)CC1=CC=C1CCC[C@]2(C)C(C(C)CCS(=O)(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C29H40O3S/c1-21-11-14-25(30)20-24(21)13-12-23-8-7-18-29(3)27(15-16-28(23)29)22(2)17-19-33(31,32)26-9-5-4-6-10-26/h4-6,9-10,12-13,22,25,27-28,30H,1,7-8,11,14-20H2,2-3H3/t22?,25-,27?,28-,29+/m0/s1 |
| InChIKey | WEYXDRDBGNJZSG-ZJZAXZQGSA-N |
| XLogP | 6.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |