C16H20ClN3O3 — CID 123348346
tert-butyl N-[1-(5-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]carbamate (PubChem CID 123348346) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is tert-butyl N-[1-(5-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 123348346 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | tert-butyl N-[1-(5-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1nc2cccc(Cl)c2c(=O)n1C |
| InChI | InChI=1S/C16H20ClN3O3/c1-9(18-15(22)23-16(2,3)4)13-19-11-8-6-7-10(17)12(11)14(21)20(13)5/h6-9H,1-5H3,(H,18,22) |
| InChIKey | QHXBNEAWLDPSFK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |