C23H25FO4S — CID 123348532
6-[1-(3-fluorophenyl)sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione (PubChem CID 123348532) has the molecular formula C23H25FO4S and a molecular weight of 416.51 g/mol. Its IUPAC name is 6-[1-(3-fluorophenyl)sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione.
| Compound Name | 6-[1-(3-fluorophenyl)sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 123348532 |
| Molecular Formula | C23H25FO4S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 6-[1-(3-fluorophenyl)sulfinylpropan-2-yl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C(C)CS(=O)c3cccc(F)c3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C23H25FO4S/c1-13-8-14(2)21(15(3)9-13)22-19(25)11-20(28-23(22)26)16(4)12-29(27)18-7-5-6-17(24)10-18/h5-10,16,20,22H,11-12H2,1-4H3 |
| InChIKey | IDARNVZXJKKOQC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|