C28H40F3NO — CID 123348548
2-ethyl-N-(7-methoxy-5-methylheptyl)-5-propan-2-yl-4-[4-(trifluoromethyl)phenyl]cyclohepta-3,5-dien-1-imine (PubChem CID 123348548) has the molecular formula C28H40F3NO and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-ethyl-N-(7-methoxy-5-methylheptyl)-5-propan-2-yl-4-[4-(trifluoromethyl)phenyl]cyclohepta-3,5-dien-1-imine.
| Compound Name | 2-ethyl-N-(7-methoxy-5-methylheptyl)-5-propan-2-yl-4-[4-(trifluoromethyl)phenyl]cyclohepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 123348548 |
| Molecular Formula | C28H40F3NO |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 2-ethyl-N-(7-methoxy-5-methylheptyl)-5-propan-2-yl-4-[4-(trifluoromethyl)phenyl]cyclohepta-3,5-dien-1-imine |
| SMILES | CCC1C=C(c2ccc(C(F)(F)F)cc2)C(C(C)C)=CC/C1=N\CCCCC(C)CCOC |
| InChI | InChI=1S/C28H40F3NO/c1-6-22-19-26(23-10-12-24(13-11-23)28(29,30)31)25(20(2)3)14-15-27(22)32-17-8-7-9-21(4)16-18-33-5/h10-14,19-22H,6-9,15-18H2,1-5H3/b32-27+ |
| InChIKey | UGWIUERYXVKRCE-QVAGMWBUSA-N |
| XLogP | 8.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|