About 1,1-difluorobutan-2-imine
1,1-difluorobutan-2-imine (PubChem CID 123348605) has the molecular formula C4H7F2N
and a molecular weight of 107.10 g/mol. Its IUPAC name is 1,1-difluorobutan-2-imine.
Molecular Properties
| Compound Name | 1,1-difluorobutan-2-imine |
| PubChem CID | 123348605 |
| Molecular Formula | C4H7F2N |
| Molecular Weight | 107.10 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 1,1-difluorobutan-2-imine |
| SMILES | [H]/N=C(\CC)C(F)F |
| InChI | InChI=1S/C4H7F2N/c1-2-3(7)4(5)6/h4,7H,2H2,1H3/b7-3+ |
| InChIKey | WUIMVBXVAKPLDN-XVNBXDOJSA-N |
| XLogP | 1.68 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.10 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluorobutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorobutan-2-imine?
The IUPAC name of 1,1-difluorobutan-2-imine (CID 123348605) is 1,1-difluorobutan-2-imine.
What is the SMILES notation for 1,1-difluorobutan-2-imine?
The canonical SMILES for 1,1-difluorobutan-2-imine is [H]/N=C(\CC)C(F)F.
What is the InChIKey of 1,1-difluorobutan-2-imine?
The InChIKey is WUIMVBXVAKPLDN-XVNBXDOJSA-N. The full InChI is InChI=1S/C4H7F2N/c1-2-3(7)4(5)6/h4,7H,2H2,1H3/b7-3+.
What are the key properties of 1,1-difluorobutan-2-imine?
1,1-difluorobutan-2-imine has a molecular weight of 107.10 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorobutan-2-imine is sourced from PubChem (CID 123348605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).