C29H33NO5S — CID 123349182
2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[2H-benzo[h][1,4]benzoxathiine-3,4'-piperidine]-5,6-dione (PubChem CID 123349182) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[2H-benzo[h][1,4]benzoxathiine-3,4'-piperidine]-5,6-dione.
| Compound Name | 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[2H-benzo[h][1,4]benzoxathiine-3,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 123349182 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[2H-benzo[h][1,4]benzoxathiine-3,4'-piperidine]-5,6-dione |
| SMILES | CC(C)(C)c1ccc(OCC(O)CC2OC3=C(SC24CCNCC4)C(=O)C(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C29H33NO5S/c1-28(2,3)18-8-10-20(11-9-18)34-17-19(31)16-23-29(12-14-30-15-13-29)36-27-25(33)24(32)21-6-4-5-7-22(21)26(27)35-23/h4-11,19,23,30-31H,12-17H2,1-3H3 |
| InChIKey | QQEUCQNGBKQGPO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|