C12H22FN3O — CID 123349275
N-(2-fluoroethyl)-2-piperidin-4-ylpyrrolidine-1-carboxamide (PubChem CID 123349275) has the molecular formula C12H22FN3O and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-piperidin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | N-(2-fluoroethyl)-2-piperidin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 123349275 |
| Molecular Formula | C12H22FN3O |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-(2-fluoroethyl)-2-piperidin-4-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(NCCF)N1CCCC1C1CCNCC1 |
| InChI | InChI=1S/C12H22FN3O/c13-5-8-15-12(17)16-9-1-2-11(16)10-3-6-14-7-4-10/h10-11,14H,1-9H2,(H,15,17) |
| InChIKey | QCVXFCGSGRCZMS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |