About 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine
4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine (PubChem CID 123349566) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine |
| PubChem CID | 123349566 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine |
| SMILES | CCSc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C8H13N3S/c1-4-12-7-5(2)6(3)10-8(9)11-7/h4H2,1-3H3,(H2,9,10,11) |
| InChIKey | YYKFPIGMMXQSDF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine?
The IUPAC name of 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine (CID 123349566) is 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine?
The canonical SMILES for 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine is CCSc1nc(N)nc(C)c1C.
What is the InChIKey of 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine?
The InChIKey is YYKFPIGMMXQSDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-4-12-7-5(2)6(3)10-8(9)11-7/h4H2,1-3H3,(H2,9,10,11).
What are the key properties of 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine?
4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine has a molecular weight of 183.28 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-5,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 123349566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).