C26H28F4N5O3+ — CID 123349572
13-[3-fluoro-4-(trifluoromethyl)phenyl]-4-(2-hydroxy-2-methylpropanoyl)-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123349572) has the molecular formula C26H28F4N5O3+ and a molecular weight of 534.53 g/mol. Its IUPAC name is 13-[3-fluoro-4-(trifluoromethyl)phenyl]-4-(2-hydroxy-2-methylpropanoyl)-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 13-[3-fluoro-4-(trifluoromethyl)phenyl]-4-(2-hydroxy-2-methylpropanoyl)-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123349572 |
| Molecular Formula | C26H28F4N5O3+ |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 13-[3-fluoro-4-(trifluoromethyl)phenyl]-4-(2-hydroxy-2-methylpropanoyl)-2-methyl-15-propan-2-yl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CC(C)c1cc(-c2ccc(C(F)(F)F)c(F)c2)nn2cc3[n+](c12)C1(C)CN(C(=O)C(C)(C)O)CCN1C3=O |
| InChI | InChI=1S/C26H28F4N5O3/c1-14(2)16-11-19(15-6-7-17(18(27)10-15)26(28,29)30)31-34-12-20-22(36)33-9-8-32(23(37)24(3,4)38)13-25(33,5)35(20)21(16)34/h6-7,10-12,14,38H,8-9,13H2,1-5H3/q+1 |
| InChIKey | GTLBJVWJMFZELT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|