About 2-ethyl-1,2,6-trimethylpyrimidine
2-ethyl-1,2,6-trimethylpyrimidine (PubChem CID 123349703) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-ethyl-1,2,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 2-ethyl-1,2,6-trimethylpyrimidine |
| PubChem CID | 123349703 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-ethyl-1,2,6-trimethylpyrimidine |
| SMILES | CCC1(C)N=CC=C(C)N1C |
| InChI | InChI=1S/C9H16N2/c1-5-9(3)10-7-6-8(2)11(9)4/h6-7H,5H2,1-4H3 |
| InChIKey | LQVBLBCRPSOMNF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1,2,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,2,6-trimethylpyrimidine?
The IUPAC name of 2-ethyl-1,2,6-trimethylpyrimidine (CID 123349703) is 2-ethyl-1,2,6-trimethylpyrimidine.
What is the SMILES notation for 2-ethyl-1,2,6-trimethylpyrimidine?
The canonical SMILES for 2-ethyl-1,2,6-trimethylpyrimidine is CCC1(C)N=CC=C(C)N1C.
What is the InChIKey of 2-ethyl-1,2,6-trimethylpyrimidine?
The InChIKey is LQVBLBCRPSOMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-9(3)10-7-6-8(2)11(9)4/h6-7H,5H2,1-4H3.
What are the key properties of 2-ethyl-1,2,6-trimethylpyrimidine?
2-ethyl-1,2,6-trimethylpyrimidine has a molecular weight of 152.24 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2,6-trimethylpyrimidine is sourced from PubChem (CID 123349703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).