C28H46O3 — CID 123349965
2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohex-1-en-5-yn-1-yl]oxyacetate (PubChem CID 123349965) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohex-1-en-5-yn-1-yl]oxyacetate.
| Compound Name | 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohex-1-en-5-yn-1-yl]oxyacetate |
|---|---|
| PubChem CID | 123349965 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 2-cyclopentylpropan-2-yl 2-[4-(3,3,6,6-tetramethyloctan-4-yl)cyclohex-1-en-5-yn-1-yl]oxyacetate |
| SMILES | CCC(C)(C)CC(C1C#CC(OCC(=O)OC(C)(C)C2CCCC2)=CC1)C(C)(C)CC |
| InChI | InChI=1S/C28H46O3/c1-9-26(3,4)19-24(27(5,6)10-2)21-15-17-23(18-16-21)30-20-25(29)31-28(7,8)22-13-11-12-14-22/h17,21-22,24H,9-15,19-20H2,1-8H3 |
| InChIKey | ZMUCWIKEAUIUQT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|