C11H14F4O — CID 123350494
2-methyl-4-(2,2,3,3-tetrafluoropropoxy)hepta-1,3,5-triene (PubChem CID 123350494) has the molecular formula C11H14F4O and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-methyl-4-(2,2,3,3-tetrafluoropropoxy)hepta-1,3,5-triene.
| Compound Name | 2-methyl-4-(2,2,3,3-tetrafluoropropoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123350494 |
| Molecular Formula | C11H14F4O |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-methyl-4-(2,2,3,3-tetrafluoropropoxy)hepta-1,3,5-triene |
| SMILES | C=C(C)C=C(C=CC)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H14F4O/c1-4-5-9(6-8(2)3)16-7-11(14,15)10(12)13/h4-6,10H,2,7H2,1,3H3 |
| InChIKey | DHMLYNUFXBCDRN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|