About 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine
2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine (PubChem CID 123350601) has the molecular formula C6H6Cl2N2O2
and a molecular weight of 209.03 g/mol. Its IUPAC name is 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine |
| PubChem CID | 123350601 |
| Molecular Formula | C6H6Cl2N2O2 |
| Molecular Weight | 209.03 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine |
| SMILES | Cc1cc(Cl)nc(Cl)c1N(O)O |
| InChI | InChI=1S/C6H6Cl2N2O2/c1-3-2-4(7)9-6(8)5(3)10(11)12/h2,11-12H,1H3 |
| InChIKey | UPPHQGMWMNSYNG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.03 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine?
The IUPAC name of 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine (CID 123350601) is 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine.
What is the SMILES notation for 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine?
The canonical SMILES for 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine is Cc1cc(Cl)nc(Cl)c1N(O)O.
What is the InChIKey of 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine?
The InChIKey is UPPHQGMWMNSYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2O2/c1-3-2-4(7)9-6(8)5(3)10(11)12/h2,11-12H,1H3.
What are the key properties of 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine?
2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine has a molecular weight of 209.03 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-N,N-dihydroxy-4-methylpyridin-3-amine is sourced from PubChem (CID 123350601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).