C30H44F3NO5 — CID 123350637
(2S,3S)-2-hydroxy-2-methyl-12-oxo-3-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]nonadec-4-enoic acid (PubChem CID 123350637) has the molecular formula C30H44F3NO5 and a molecular weight of 555.68 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-2-methyl-12-oxo-3-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]nonadec-4-enoic acid.
| Compound Name | (2S,3S)-2-hydroxy-2-methyl-12-oxo-3-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]nonadec-4-enoic acid |
|---|---|
| PubChem CID | 123350637 |
| Molecular Formula | C30H44F3NO5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | (2S,3S)-2-hydroxy-2-methyl-12-oxo-3-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoyl]nonadec-4-enoic acid |
| SMILES | CCCCCCCC(=O)CCCCCCC=C[C@H](C(=O)NCCc1ccc(C(F)(F)F)cc1)[C@](C)(O)C(=O)O |
| InChI | InChI=1S/C30H44F3NO5/c1-3-4-5-8-11-14-25(35)15-12-9-6-7-10-13-16-26(29(2,39)28(37)38)27(36)34-22-21-23-17-19-24(20-18-23)30(31,32)33/h13,16-20,26,39H,3-12,14-15,21-22H2,1-2H3,(H,34,36)(H,37,38)/t26-,29+/m1/s1 |
| InChIKey | VSLJEAUBJGVEGG-UHSQPCAPSA-N |
| XLogP | 6.64 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|