About N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine
N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine (PubChem CID 123350722) has the molecular formula C13H12F3N7
and a molecular weight of 323.28 g/mol. Its IUPAC name is N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine.
Molecular Properties
| Compound Name | N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine |
| PubChem CID | 123350722 |
| Molecular Formula | C13H12F3N7 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine |
| SMILES | C=Nc1ncnc2c1nc(-c1cnn(CC(F)(F)F)c1)n2CC |
| InChI | InChI=1S/C13H12F3N7/c1-3-23-11(8-4-20-22(5-8)6-13(14,15)16)21-9-10(17-2)18-7-19-12(9)23/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | MPBXTQIWDPOBBR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine?
The IUPAC name of N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine (CID 123350722) is N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine.
What is the SMILES notation for N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine?
The canonical SMILES for N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine is C=Nc1ncnc2c1nc(-c1cnn(CC(F)(F)F)c1)n2CC.
What is the InChIKey of N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine?
The InChIKey is MPBXTQIWDPOBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N7/c1-3-23-11(8-4-20-22(5-8)6-13(14,15)16)21-9-10(17-2)18-7-19-12(9)23/h4-5,7H,2-3,6H2,1H3.
What are the key properties of N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine?
N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine has a molecular weight of 323.28 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-ethyl-8-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]purin-6-yl]methanimine is sourced from PubChem (CID 123350722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).