About (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine
(E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine (PubChem CID 123350861) has the molecular formula C6H8BrF2N
and a molecular weight of 212.04 g/mol. Its IUPAC name is (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine |
| PubChem CID | 123350861 |
| Molecular Formula | C6H8BrF2N |
| Molecular Weight | 212.04 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine |
| SMILES | C/C(Br)=C\C=N\CC(F)F |
| InChI | InChI=1S/C6H8BrF2N/c1-5(7)2-3-10-4-6(8)9/h2-3,6H,4H2,1H3/b5-2+,10-3+ |
| InChIKey | LRZIZFAXQKSBAW-SDHXOLAESA-N |
| XLogP | 2.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.04 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine?
The IUPAC name of (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine (CID 123350861) is (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine.
What is the SMILES notation for (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine?
The canonical SMILES for (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine is C/C(Br)=C\C=N\CC(F)F.
What is the InChIKey of (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine?
The InChIKey is LRZIZFAXQKSBAW-SDHXOLAESA-N. The full InChI is InChI=1S/C6H8BrF2N/c1-5(7)2-3-10-4-6(8)9/h2-3,6H,4H2,1H3/b5-2+,10-3+.
What are the key properties of (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine?
(E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine has a molecular weight of 212.04 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-bromo-N-(2,2-difluoroethyl)but-2-en-1-imine is sourced from PubChem (CID 123350861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).