C29H48ClF3N4O5SSi — CID 123351142
N-[4-chloro-6-[[2-methyl-2-pentyl-4-(2-triethylsilyloxyethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 123351142) has the molecular formula C29H48ClF3N4O5SSi and a molecular weight of 685.33 g/mol. Its IUPAC name is N-[4-chloro-6-[[2-methyl-2-pentyl-4-(2-triethylsilyloxyethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-chloro-6-[[2-methyl-2-pentyl-4-(2-triethylsilyloxyethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 123351142 |
| Molecular Formula | C29H48ClF3N4O5SSi |
| Molecular Weight | 685.33 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | N-[4-chloro-6-[[2-methyl-2-pentyl-4-(2-triethylsilyloxyethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]amino]-2-propylsulfanylpyrimidin-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCCC1(C)OC2C(Nc3nc(SCCC)nc(Cl)c3NC(=O)C(F)(F)F)CC(OCCO[Si](CC)(CC)CC)C2O1 |
| InChI | InChI=1S/C29H48ClF3N4O5SSi/c1-7-12-13-14-28(6)41-22-19(18-20(23(22)42-28)39-15-16-40-44(9-3,10-4)11-5)34-25-21(35-26(38)29(31,32)33)24(30)36-27(37-25)43-17-8-2/h19-20,22-23H,7-18H2,1-6H3,(H,35,38)(H,34,36,37) |
| InChIKey | CYXVTHQOWLRDFM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.33 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|