C15H20ClN3O3Si — CID 123351166
2-[[5-(3-chlorophenyl)-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123351166) has the molecular formula C15H20ClN3O3Si and a molecular weight of 353.88 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(3-chlorophenyl)-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123351166 |
| Molecular Formula | C15H20ClN3O3Si |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-4-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc([N+](=O)[O-])c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O3Si/c1-23(2,3)8-7-22-11-18-15(14(10-17-18)19(20)21)12-5-4-6-13(16)9-12/h4-6,9-10H,7-8,11H2,1-3H3 |
| InChIKey | QMJSHRNQYUXCQU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|