About 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate
6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate (PubChem CID 123351306) has the molecular formula C12H26O11P2
and a molecular weight of 408.28 g/mol. Its IUPAC name is 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate |
| PubChem CID | 123351306 |
| Molecular Formula | C12H26O11P2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate |
| SMILES | COP(=O)(O)OCC1OCC(O)C1OP(=O)(O)OCCCCCCO |
| InChI | InChI=1S/C12H26O11P2/c1-19-24(15,16)22-9-11-12(10(14)8-20-11)23-25(17,18)21-7-5-3-2-4-6-13/h10-14H,2-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZPMFPESZMPBVKC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate?
The IUPAC name of 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate (CID 123351306) is 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate.
What is the SMILES notation for 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate?
The canonical SMILES for 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate is COP(=O)(O)OCC1OCC(O)C1OP(=O)(O)OCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate?
The InChIKey is ZPMFPESZMPBVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O11P2/c1-19-24(15,16)22-9-11-12(10(14)8-20-11)23-25(17,18)21-7-5-3-2-4-6-13/h10-14H,2-9H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate?
6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate has a molecular weight of 408.28 g/mol, XLogP of 0.56, 13 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl [4-hydroxy-2-[[hydroxy(methoxy)phosphoryl]oxymethyl]oxolan-3-yl] hydrogen phosphate is sourced from PubChem (CID 123351306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).