About 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one
5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one (PubChem CID 123351635) has the molecular formula C15H19NO5S
and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one |
| PubChem CID | 123351635 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one |
| SMILES | CCS(O)(O)c1ccc(OC)c(-c2cc(O)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C15H19NO5S/c1-4-22(19,20)11-5-6-14(21-3)12(8-11)10-7-13(17)15(18)16(2)9-10/h5-9,17,19-20H,4H2,1-3H3 |
| InChIKey | HXFASWQBEIRAJH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one?
The IUPAC name of 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one (CID 123351635) is 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one.
What is the SMILES notation for 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one?
The canonical SMILES for 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one is CCS(O)(O)c1ccc(OC)c(-c2cc(O)c(=O)n(C)c2)c1.
What is the InChIKey of 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one?
The InChIKey is HXFASWQBEIRAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5S/c1-4-22(19,20)11-5-6-14(21-3)12(8-11)10-7-13(17)15(18)16(2)9-10/h5-9,17,19-20H,4H2,1-3H3.
What are the key properties of 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one?
5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one has a molecular weight of 325.39 g/mol, XLogP of 2.90, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[ethyl(dihydroxy)-λ4-sulfanyl]-2-methoxyphenyl]-3-hydroxy-1-methylpyridin-2-one is sourced from PubChem (CID 123351635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).