C12H12ClN3 — CID 123352142
3-(2-chloro-2,5-dihydropyridin-3-yl)-8-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 123352142) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-(2-chloro-2,5-dihydropyridin-3-yl)-8-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-(2-chloro-2,5-dihydropyridin-3-yl)-8-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 123352142 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-(2-chloro-2,5-dihydropyridin-3-yl)-8-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Cn1[nH]c2ccc(C3=CCC=NC3Cl)cc21 |
| InChI | InChI=1S/C12H12ClN3/c1-16-11-7-8(4-5-10(11)15-16)9-3-2-6-14-12(9)13/h3-7,12,15H,2H2,1H3 |
| InChIKey | LZIQHHQUORRQMW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|