About (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine
(7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine (PubChem CID 123352256) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine.
Molecular Properties
| Compound Name | (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine |
| PubChem CID | 123352256 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine |
| SMILES | CC1=CCC(N)N=C/C=C\C1 |
| InChI | InChI=1S/C9H14N2/c1-8-4-2-3-7-11-9(10)6-5-8/h2-3,5,7,9H,4,6,10H2,1H3/b3-2-,8-5?,11-7? |
| InChIKey | FYGSJACUZNNEKQ-IBQRCDPWSA-N |
| XLogP | 1.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine?
The IUPAC name of (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine (CID 123352256) is (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine.
What is the SMILES notation for (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine?
The canonical SMILES for (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine is CC1=CCC(N)N=C/C=C\C1.
What is the InChIKey of (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine?
The InChIKey is FYGSJACUZNNEKQ-IBQRCDPWSA-N. The full InChI is InChI=1S/C9H14N2/c1-8-4-2-3-7-11-9(10)6-5-8/h2-3,5,7,9H,4,6,10H2,1H3/b3-2-,8-5?,11-7?.
What are the key properties of (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine?
(7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine has a molecular weight of 150.22 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-5-methyl-3,6-dihydro-2H-azonin-2-amine is sourced from PubChem (CID 123352256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).