C36H47N5O4Si2 — CID 123352548
2-[4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]methyl]phenyl]acetic acid (PubChem CID 123352548) has the molecular formula C36H47N5O4Si2 and a molecular weight of 669.98 g/mol. Its IUPAC name is 2-[4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 123352548 |
| Molecular Formula | C36H47N5O4Si2 |
| Molecular Weight | 669.98 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | 2-[4-[[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]methyl]phenyl]acetic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(Cc2ccc(CC(=O)O)cc2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C36H47N5O4Si2/c1-46(2,3)17-15-44-25-40(26-45-16-18-47(4,5)6)34-22-31(19-27-11-13-28(14-12-27)20-35(42)43)39-36-32(24-38-41(34)36)30-21-29-9-7-8-10-33(29)37-23-30/h7-14,21-24H,15-20,25-26H2,1-6H3,(H,42,43) |
| InChIKey | OHMKHDBNQSTNCS-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.98 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|